C19H24F3NO2 — CID 2801498
[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 2,2,2-trifluoroacetate (PubChem CID 2801498) has the molecular formula C19H24F3NO2 and a molecular weight of 355.40 g/mol. Its IUPAC name is [1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 2,2,2-trifluoroacetate.
| Compound Name | [1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 2801498 |
| Molecular Formula | C19H24F3NO2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 2,2,2-trifluoroacetate |
| SMILES | CC(=NOC(=O)C(F)(F)F)c1cc(C(C)(C)C)cc2c1CCC2(C)C |
| InChI | InChI=1S/C19H24F3NO2/c1-11(23-25-16(24)19(20,21)22)14-9-12(17(2,3)4)10-15-13(14)7-8-18(15,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | NJESEUPOLBKJOP-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|