C24H28N2O4 — CID 2801548
[1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 4-nitrobenzoate (PubChem CID 2801548) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 4-nitrobenzoate.
| Compound Name | [1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 2801548 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [1-(6-tert-butyl-1,1-dimethyl-2,3-dihydroinden-4-yl)ethylideneamino] 4-nitrobenzoate |
| SMILES | CC(=NOC(=O)c1ccc([N+](=O)[O-])cc1)c1cc(C(C)(C)C)cc2c1CCC2(C)C |
| InChI | InChI=1S/C24H28N2O4/c1-15(25-30-22(27)16-7-9-18(10-8-16)26(28)29)20-13-17(23(2,3)4)14-21-19(20)11-12-24(21,5)6/h7-10,13-14H,11-12H2,1-6H3 |
| InChIKey | XJILGALUFODUSW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|