About 2,3-diphenylthiophene
2,3-diphenylthiophene (PubChem CID 2801736) has the molecular formula C16H12S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 2,3-diphenylthiophene.
Molecular Properties
| Compound Name | 2,3-diphenylthiophene |
| PubChem CID | 2801736 |
| Molecular Formula | C16H12S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2,3-diphenylthiophene |
| SMILES | c1ccc(-c2ccsc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12S/c1-3-7-13(8-4-1)15-11-12-17-16(15)14-9-5-2-6-10-14/h1-12H |
| InChIKey | RZFOAVRHEGQZRV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-diphenylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenylthiophene?
The IUPAC name of 2,3-diphenylthiophene (CID 2801736) is 2,3-diphenylthiophene.
What is the SMILES notation for 2,3-diphenylthiophene?
The canonical SMILES for 2,3-diphenylthiophene is c1ccc(-c2ccsc2-c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenylthiophene?
The InChIKey is RZFOAVRHEGQZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12S/c1-3-7-13(8-4-1)15-11-12-17-16(15)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 2,3-diphenylthiophene?
2,3-diphenylthiophene has a molecular weight of 236.34 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenylthiophene is sourced from PubChem (CID 2801736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).