C14H16N6OS — CID 2801887
N,N-diethyl-2-([1,2,4]triazolo[3,4-c][1,2,4]benzotriazin-1-ylsulfanyl)acetamide (PubChem CID 2801887) has the molecular formula C14H16N6OS and a molecular weight of 316.39 g/mol. Its IUPAC name is N,N-diethyl-2-([1,2,4]triazolo[3,4-c][1,2,4]benzotriazin-1-ylsulfanyl)acetamide.
| Compound Name | N,N-diethyl-2-([1,2,4]triazolo[3,4-c][1,2,4]benzotriazin-1-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2801887 |
| Molecular Formula | C14H16N6OS |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N,N-diethyl-2-([1,2,4]triazolo[3,4-c][1,2,4]benzotriazin-1-ylsulfanyl)acetamide |
| SMILES | CCN(CC)C(=O)CSc1nnc2nnc3ccccc3n12 |
| InChI | InChI=1S/C14H16N6OS/c1-3-19(4-2)12(21)9-22-14-18-17-13-16-15-10-7-5-6-8-11(10)20(13)14/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | ZTMHLKABQGKOOD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |