About 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride
8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride (PubChem CID 2801964) has the molecular formula C19H14ClNO3S
and a molecular weight of 371.85 g/mol. Its IUPAC name is 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride.
Molecular Properties
| Compound Name | 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride |
| PubChem CID | 2801964 |
| Molecular Formula | C19H14ClNO3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride |
| SMILES | Cn1c(=O)c2ccccc2[s+]1-c1cccc2cccc(C(=O)O)c12.[Cl-] |
| InChI | InChI=1S/C19H13NO3S.ClH/c1-20-18(21)13-8-2-3-10-15(13)24(20)16-11-5-7-12-6-4-9-14(17(12)16)19(22)23;/h2-11H,1H3;1H |
| InChIKey | KZQSVTULOFETTN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride?
The IUPAC name of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride (CID 2801964) is 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride.
What is the SMILES notation for 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride?
The canonical SMILES for 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride is Cn1c(=O)c2ccccc2[s+]1-c1cccc2cccc(C(=O)O)c12.[Cl-].
What is the InChIKey of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride?
The InChIKey is KZQSVTULOFETTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO3S.ClH/c1-20-18(21)13-8-2-3-10-15(13)24(20)16-11-5-7-12-6-4-9-14(17(12)16)19(22)23;/h2-11H,1H3;1H.
What are the key properties of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride?
8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride has a molecular weight of 371.85 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid chloride is sourced from PubChem (CID 2801964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).