About 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid
8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid (PubChem CID 2801965) has the molecular formula C19H14NO3S+
and a molecular weight of 336.39 g/mol. Its IUPAC name is 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid.
Molecular Properties
| Compound Name | 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid |
| PubChem CID | 2801965 |
| Molecular Formula | C19H14NO3S+ |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid |
| SMILES | Cn1c(=O)c2ccccc2[s+]1-c1cccc2cccc(C(=O)O)c12 |
| InChI | InChI=1S/C19H13NO3S/c1-20-18(21)13-8-2-3-10-15(13)24(20)16-11-5-7-12-6-4-9-14(17(12)16)19(22)23/h2-11H,1H3/p+1 |
| InChIKey | UXBINXNSVOYXPR-UHFFFAOYSA-O |
| XLogP | 4.13 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid?
The IUPAC name of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid (CID 2801965) is 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid.
What is the SMILES notation for 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid?
The canonical SMILES for 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid is Cn1c(=O)c2ccccc2[s+]1-c1cccc2cccc(C(=O)O)c12.
What is the InChIKey of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid?
The InChIKey is UXBINXNSVOYXPR-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H13NO3S/c1-20-18(21)13-8-2-3-10-15(13)24(20)16-11-5-7-12-6-4-9-14(17(12)16)19(22)23/h2-11H,1H3/p+1.
What are the key properties of 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid?
8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid has a molecular weight of 336.39 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-methyl-3-oxo-1,2-benzothiazol-1-ium-1-yl)naphthalene-1-carboxylic acid is sourced from PubChem (CID 2801965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).