About ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate
ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate (PubChem CID 2802191) has the molecular formula C8H12N2O2S3
and a molecular weight of 264.40 g/mol. Its IUPAC name is ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate.
Molecular Properties
| Compound Name | ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate |
| PubChem CID | 2802191 |
| Molecular Formula | C8H12N2O2S3 |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate |
| SMILES | CCOC(=O)CCCSc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C8H12N2O2S3/c1-2-12-6(11)4-3-5-14-8-10-9-7(13)15-8/h2-5H2,1H3,(H,9,13) |
| InChIKey | ABFDJGBWETYPLL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate?
The IUPAC name of ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate (CID 2802191) is ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate.
What is the SMILES notation for ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate?
The canonical SMILES for ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate is CCOC(=O)CCCSc1n[nH]c(=S)s1.
What is the InChIKey of ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate?
The InChIKey is ABFDJGBWETYPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S3/c1-2-12-6(11)4-3-5-14-8-10-9-7(13)15-8/h2-5H2,1H3,(H,9,13).
What are the key properties of ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate?
ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate has a molecular weight of 264.40 g/mol, XLogP of 2.64, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]butanoate is sourced from PubChem (CID 2802191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).