About 2,2-dimethylpropyl 4-bromobenzenesulfonate
2,2-dimethylpropyl 4-bromobenzenesulfonate (PubChem CID 2802228) has the molecular formula C11H15BrO3S
and a molecular weight of 307.21 g/mol. Its IUPAC name is 2,2-dimethylpropyl 4-bromobenzenesulfonate.
Molecular Properties
| Compound Name | 2,2-dimethylpropyl 4-bromobenzenesulfonate |
| PubChem CID | 2802228 |
| Molecular Formula | C11H15BrO3S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2,2-dimethylpropyl 4-bromobenzenesulfonate |
| SMILES | CC(C)(C)COS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H15BrO3S/c1-11(2,3)8-15-16(13,14)10-6-4-9(12)5-7-10/h4-7H,8H2,1-3H3 |
| InChIKey | PVJBARUAGAVJSY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropyl 4-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropyl 4-bromobenzenesulfonate?
The IUPAC name of 2,2-dimethylpropyl 4-bromobenzenesulfonate (CID 2802228) is 2,2-dimethylpropyl 4-bromobenzenesulfonate.
What is the SMILES notation for 2,2-dimethylpropyl 4-bromobenzenesulfonate?
The canonical SMILES for 2,2-dimethylpropyl 4-bromobenzenesulfonate is CC(C)(C)COS(=O)(=O)c1ccc(Br)cc1.
What is the InChIKey of 2,2-dimethylpropyl 4-bromobenzenesulfonate?
The InChIKey is PVJBARUAGAVJSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO3S/c1-11(2,3)8-15-16(13,14)10-6-4-9(12)5-7-10/h4-7H,8H2,1-3H3.
What are the key properties of 2,2-dimethylpropyl 4-bromobenzenesulfonate?
2,2-dimethylpropyl 4-bromobenzenesulfonate has a molecular weight of 307.21 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropyl 4-bromobenzenesulfonate is sourced from PubChem (CID 2802228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).