C22H16O4 — CID 2802240
16,16-dimethyl-9-phenyl-3,8,17-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1,4,6,9,12,14-hexaen-11-one (PubChem CID 2802240) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is 16,16-dimethyl-9-phenyl-3,8,17-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1,4,6,9,12,14-hexaen-11-one.
| Compound Name | 16,16-dimethyl-9-phenyl-3,8,17-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1,4,6,9,12,14-hexaen-11-one |
|---|---|
| PubChem CID | 2802240 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 16,16-dimethyl-9-phenyl-3,8,17-trioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1,4,6,9,12,14-hexaen-11-one |
| SMILES | CC1(C)C=Cc2c(c3occc3c3oc(-c4ccccc4)cc(=O)c23)O1 |
| InChI | InChI=1S/C22H16O4/c1-22(2)10-8-14-18-16(23)12-17(13-6-4-3-5-7-13)25-19(18)15-9-11-24-20(15)21(14)26-22/h3-12H,1-2H3 |
| InChIKey | FVPDHIHSSUEMOI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |