About N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine
N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 2802274) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 2802274 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC1CN=C(NC2CCCCC2)S1 |
| InChI | InChI=1S/C10H18N2S/c1-8-7-11-10(13-8)12-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H,11,12) |
| InChIKey | YTOWYFLOSOHRDY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine (CID 2802274) is N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine is CC1CN=C(NC2CCCCC2)S1.
What is the InChIKey of N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is YTOWYFLOSOHRDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-8-7-11-10(13-8)12-9-5-3-2-4-6-9/h8-9H,2-7H2,1H3,(H,11,12).
What are the key properties of N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 198.33 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 2802274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).