About 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine
5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine (PubChem CID 2802278) has the molecular formula C12H16N2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine |
| PubChem CID | 2802278 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine |
| SMILES | Cc1ccccc1NC1=NCC(C)(C)S1 |
| InChI | InChI=1S/C12H16N2S/c1-9-6-4-5-7-10(9)14-11-13-8-12(2,3)15-11/h4-7H,8H2,1-3H3,(H,13,14) |
| InChIKey | JTQRHHYZHKNFEP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine?
The IUPAC name of 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine (CID 2802278) is 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine.
What is the SMILES notation for 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine?
The canonical SMILES for 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine is Cc1ccccc1NC1=NCC(C)(C)S1.
What is the InChIKey of 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine?
The InChIKey is JTQRHHYZHKNFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2S/c1-9-6-4-5-7-10(9)14-11-13-8-12(2,3)15-11/h4-7H,8H2,1-3H3,(H,13,14).
What are the key properties of 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine?
5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine has a molecular weight of 220.34 g/mol, XLogP of 3.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-N-(2-methylphenyl)-4H-1,3-thiazol-2-amine is sourced from PubChem (CID 2802278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).