C15H16FN3O — CID 2802374
8-fluoro-N-prop-2-enyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 2802374) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is 8-fluoro-N-prop-2-enyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | 8-fluoro-N-prop-2-enyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 2802374 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 8-fluoro-N-prop-2-enyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | C=CCNC(=O)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C15H16FN3O/c1-2-6-17-15(20)19-7-5-14-12(9-19)11-8-10(16)3-4-13(11)18-14/h2-4,8,18H,1,5-7,9H2,(H,17,20) |
| InChIKey | RXSSNHNJJJGLRO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|