C18H21FN2O — CID 2802375
cyclohexyl-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 2802375) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is cyclohexyl-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | cyclohexyl-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 2802375 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | cyclohexyl-(8-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | O=C(C1CCCCC1)N1CCc2[nH]c3ccc(F)cc3c2C1 |
| InChI | InChI=1S/C18H21FN2O/c19-13-6-7-16-14(10-13)15-11-21(9-8-17(15)20-16)18(22)12-4-2-1-3-5-12/h6-7,10,12,20H,1-5,8-9,11H2 |
| InChIKey | YHRBLBBUSHXYDL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|