About 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate
2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate (PubChem CID 2802419) has the molecular formula C8H20N4O5
and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate.
Molecular Properties
| Compound Name | 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate |
| PubChem CID | 2802419 |
| Molecular Formula | C8H20N4O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)O.O.O |
| InChI | InChI=1S/C8H16N4O3.2H2O/c1-5(13)12-6(7(14)15)3-2-4-11-8(9)10;;/h6H,2-4H2,1H3,(H,12,13)(H,14,15)(H4,9,10,11);2*1H2 |
| InChIKey | GCUXDHOAJIMUEB-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 193.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate?
The IUPAC name of 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate (CID 2802419) is 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate.
What is the SMILES notation for 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate?
The canonical SMILES for 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate is CC(=O)NC(CCCN=C(N)N)C(=O)O.O.O.
What is the InChIKey of 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate?
The InChIKey is GCUXDHOAJIMUEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O3.2H2O/c1-5(13)12-6(7(14)15)3-2-4-11-8(9)10;;/h6H,2-4H2,1H3,(H,12,13)(H,14,15)(H4,9,10,11);2*1H2.
What are the key properties of 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate?
2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate has a molecular weight of 252.27 g/mol, XLogP of -3.02, 6 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-5-(diaminomethylideneamino)pentanoic acid;dihydrate is sourced from PubChem (CID 2802419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).