About benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid
benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid (PubChem CID 2802425) has the molecular formula C17H21NO5S
and a molecular weight of 351.42 g/mol. Its IUPAC name is benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid |
| PubChem CID | 2802425 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid |
| SMILES | C[C@@H](N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H13NO2.C7H8O3S/c1-8(11)10(12)13-7-9-5-3-2-4-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,8H,7,11H2,1H3;2-5H,1H3,(H,8,9,10)/t8-;/m1./s1 |
| InChIKey | NWOPHJSSBMABBD-DDWIOCJRSA-N |
| XLogP | 2.32 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid?
The IUPAC name of benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid (CID 2802425) is benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid.
What is the SMILES notation for benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid?
The canonical SMILES for benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid is C[C@@H](N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1.
What is the InChIKey of benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid?
The InChIKey is NWOPHJSSBMABBD-DDWIOCJRSA-N. The full InChI is InChI=1S/C10H13NO2.C7H8O3S/c1-8(11)10(12)13-7-9-5-3-2-4-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h2-6,8H,7,11H2,1H3;2-5H,1H3,(H,8,9,10)/t8-;/m1./s1.
What are the key properties of benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid?
benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid has a molecular weight of 351.42 g/mol, XLogP of 2.32, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid is sourced from PubChem (CID 2802425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).