2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid

C6H10O4S2 — CID 2802503

IUPAC2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid
SMILESO=C(O)CSC1CCS(=O)(=O)C1
InChIInChI=1S/C6H10O4S2/c7-6(8)3-11-5-1-2-12(9,10)4-5/h5H,1-4H2,(H,7,8)
InChIKeyAJTOTGKRRDVGAK-UHFFFAOYSA-N
MW210.28 g/mol
LogP-0.01
Rot. Bonds3

About 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid

2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid (PubChem CID 2802503) has the molecular formula C6H10O4S2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid.

Molecular Properties

Compound Name2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid
PubChem CID2802503
Molecular FormulaC6H10O4S2
Molecular Weight210.28 g/mol
Exact Mass210.00
IUPAC Name2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid
SMILESO=C(O)CSC1CCS(=O)(=O)C1
InChIInChI=1S/C6H10O4S2/c7-6(8)3-11-5-1-2-12(9,10)4-5/h5H,1-4H2,(H,7,8)
InChIKeyAJTOTGKRRDVGAK-UHFFFAOYSA-N
XLogP-0.01
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.28
LogP ≤ 5-0.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid (CID 2802503) is 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid is O=C(O)CSC1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid?
The InChIKey is AJTOTGKRRDVGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4S2/c7-6(8)3-11-5-1-2-12(9,10)4-5/h5H,1-4H2,(H,7,8).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid?
2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid has a molecular weight of 210.28 g/mol, XLogP of -0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)sulfanylacetic acid is sourced from PubChem (CID 2802503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).