About 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione
2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione (PubChem CID 2802595) has the molecular formula C12H20N2O4
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione.
Molecular Properties
| Compound Name | 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione |
| PubChem CID | 2802595 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione |
| SMILES | O=C(C(O)C(O)C(=O)N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C12H20N2O4/c15-9(11(17)13-5-1-2-6-13)10(16)12(18)14-7-3-4-8-14/h9-10,15-16H,1-8H2 |
| InChIKey | VWHUHPJIJJEZFI-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
The IUPAC name of 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione (CID 2802595) is 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione.
What is the SMILES notation for 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
The canonical SMILES for 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione is O=C(C(O)C(O)C(=O)N1CCCC1)N1CCCC1.
What is the InChIKey of 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
The InChIKey is VWHUHPJIJJEZFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O4/c15-9(11(17)13-5-1-2-6-13)10(16)12(18)14-7-3-4-8-14/h9-10,15-16H,1-8H2.
What are the key properties of 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione?
2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione has a molecular weight of 256.30 g/mol, XLogP of -1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-1,4-dipyrrolidin-1-ylbutane-1,4-dione is sourced from PubChem (CID 2802595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).