C16H20Cl3NO2S — CID 2802650
2,4,5-trichloro-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzenesulfonamide (PubChem CID 2802650) has the molecular formula C16H20Cl3NO2S and a molecular weight of 396.77 g/mol. Its IUPAC name is 2,4,5-trichloro-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzenesulfonamide.
| Compound Name | 2,4,5-trichloro-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2802650 |
| Molecular Formula | C16H20Cl3NO2S |
| Molecular Weight | 396.77 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 2,4,5-trichloro-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzenesulfonamide |
| SMILES | CC12CCC(C1)C(C)(C)C2NS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H20Cl3NO2S/c1-15(2)9-4-5-16(3,8-9)14(15)20-23(21,22)13-7-11(18)10(17)6-12(13)19/h6-7,9,14,20H,4-5,8H2,1-3H3 |
| InChIKey | HYPWZYISERGSIB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|