About (4-phenoxyphenyl) 4-aminobenzoate
(4-phenoxyphenyl) 4-aminobenzoate (PubChem CID 2802704) has the molecular formula C19H15NO3
and a molecular weight of 305.33 g/mol. Its IUPAC name is (4-phenoxyphenyl) 4-aminobenzoate.
Molecular Properties
| Compound Name | (4-phenoxyphenyl) 4-aminobenzoate |
| PubChem CID | 2802704 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (4-phenoxyphenyl) 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)Oc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C19H15NO3/c20-15-8-6-14(7-9-15)19(21)23-18-12-10-17(11-13-18)22-16-4-2-1-3-5-16/h1-13H,20H2 |
| InChIKey | MAIADPFQYQKTLE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-phenoxyphenyl) 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl) 4-aminobenzoate?
The IUPAC name of (4-phenoxyphenyl) 4-aminobenzoate (CID 2802704) is (4-phenoxyphenyl) 4-aminobenzoate.
What is the SMILES notation for (4-phenoxyphenyl) 4-aminobenzoate?
The canonical SMILES for (4-phenoxyphenyl) 4-aminobenzoate is Nc1ccc(C(=O)Oc2ccc(Oc3ccccc3)cc2)cc1.
What is the InChIKey of (4-phenoxyphenyl) 4-aminobenzoate?
The InChIKey is MAIADPFQYQKTLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO3/c20-15-8-6-14(7-9-15)19(21)23-18-12-10-17(11-13-18)22-16-4-2-1-3-5-16/h1-13H,20H2.
What are the key properties of (4-phenoxyphenyl) 4-aminobenzoate?
(4-phenoxyphenyl) 4-aminobenzoate has a molecular weight of 305.33 g/mol, XLogP of 4.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl) 4-aminobenzoate is sourced from PubChem (CID 2802704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).