C25H24N4O3 — CID 2802711
8-methyl-1,3-diphenyl-5-piperidin-1-ylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 2802711) has the molecular formula C25H24N4O3 and a molecular weight of 428.49 g/mol. Its IUPAC name is 8-methyl-1,3-diphenyl-5-piperidin-1-ylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 8-methyl-1,3-diphenyl-5-piperidin-1-ylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 2802711 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 8-methyl-1,3-diphenyl-5-piperidin-1-ylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)cc(N2CCCCC2)c2c(=O)n(-c3ccccc3)c(=O)n(-c3ccccc3)c21 |
| InChI | InChI=1S/C25H24N4O3/c1-26-21(30)17-20(27-15-9-4-10-16-27)22-23(26)28(18-11-5-2-6-12-18)25(32)29(24(22)31)19-13-7-3-8-14-19/h2-3,5-8,11-14,17H,4,9-10,15-16H2,1H3 |
| InChIKey | IQYYKFJWSZHZNR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 69.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |