About N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide
N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (PubChem CID 2802738) has the molecular formula C17H16N2O2S
and a molecular weight of 312.39 g/mol. Its IUPAC name is N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| PubChem CID | 2802738 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide |
| SMILES | O=C(CC1Sc2ccccc2NC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H16N2O2S/c20-16(18-11-12-6-2-1-3-7-12)10-15-17(21)19-13-8-4-5-9-14(13)22-15/h1-9,15H,10-11H2,(H,18,20)(H,19,21) |
| InChIKey | JEUQSVWLOPCDJW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
The IUPAC name of N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide (CID 2802738) is N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide.
What is the SMILES notation for N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
The canonical SMILES for N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide is O=C(CC1Sc2ccccc2NC1=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
The InChIKey is JEUQSVWLOPCDJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2S/c20-16(18-11-12-6-2-1-3-7-12)10-15-17(21)19-13-8-4-5-9-14(13)22-15/h1-9,15H,10-11H2,(H,18,20)(H,19,21).
What are the key properties of N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide?
N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide has a molecular weight of 312.39 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetamide is sourced from PubChem (CID 2802738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).