About 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide
2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide (PubChem CID 2802742) has the molecular formula C31H48N2O2
and a molecular weight of 480.74 g/mol. Its IUPAC name is 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide.
Molecular Properties
| Compound Name | 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide |
| PubChem CID | 2802742 |
| Molecular Formula | C31H48N2O2 |
| Molecular Weight | 480.74 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide |
| SMILES | CC(NC(=O)C(C(=O)NC(C)C1CC2CCC1C2)C12CC3CC(CC(C3)C1)C2)C1CC2CCC1C2 |
| InChI | InChI=1S/C31H48N2O2/c1-17(26-12-19-3-5-24(26)10-19)32-29(34)28(31-14-21-7-22(15-31)9-23(8-21)16-31)30(35)33-18(2)27-13-20-4-6-25(27)11-20/h17-28H,3-16H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | RQIKJHBGAARHAO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide?
The IUPAC name of 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide (CID 2802742) is 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide.
What is the SMILES notation for 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide?
The canonical SMILES for 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide is CC(NC(=O)C(C(=O)NC(C)C1CC2CCC1C2)C12CC3CC(CC(C3)C1)C2)C1CC2CCC1C2.
What is the InChIKey of 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide?
The InChIKey is RQIKJHBGAARHAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H48N2O2/c1-17(26-12-19-3-5-24(26)10-19)32-29(34)28(31-14-21-7-22(15-31)9-23(8-21)16-31)30(35)33-18(2)27-13-20-4-6-25(27)11-20/h17-28H,3-16H2,1-2H3,(H,32,34)(H,33,35).
What are the key properties of 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide?
2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide has a molecular weight of 480.74 g/mol, XLogP of 5.70, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantyl)-N,N'-bis[1-(2-bicyclo[2.2.1]heptanyl)ethyl]propanediamide is sourced from PubChem (CID 2802742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).