About 1,5-dibromoadamantane-2,6-dione
1,5-dibromoadamantane-2,6-dione (PubChem CID 2802823) has the molecular formula C10H10Br2O2
and a molecular weight of 322.00 g/mol. Its IUPAC name is 1,5-dibromoadamantane-2,6-dione.
Molecular Properties
| Compound Name | 1,5-dibromoadamantane-2,6-dione |
| PubChem CID | 2802823 |
| Molecular Formula | C10H10Br2O2 |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.90 |
| IUPAC Name | 1,5-dibromoadamantane-2,6-dione |
| SMILES | O=C1C2CC3CC1(Br)CC(Br)(C2)C3=O |
| InChI | InChI=1S/C10H10Br2O2/c11-9-2-5-1-6(8(9)14)3-10(12,4-9)7(5)13/h5-6H,1-4H2 |
| InChIKey | CUKJLWYGSXJZHD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dibromoadamantane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibromoadamantane-2,6-dione?
The IUPAC name of 1,5-dibromoadamantane-2,6-dione (CID 2802823) is 1,5-dibromoadamantane-2,6-dione.
What is the SMILES notation for 1,5-dibromoadamantane-2,6-dione?
The canonical SMILES for 1,5-dibromoadamantane-2,6-dione is O=C1C2CC3CC1(Br)CC(Br)(C2)C3=O.
What is the InChIKey of 1,5-dibromoadamantane-2,6-dione?
The InChIKey is CUKJLWYGSXJZHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Br2O2/c11-9-2-5-1-6(8(9)14)3-10(12,4-9)7(5)13/h5-6H,1-4H2.
What are the key properties of 1,5-dibromoadamantane-2,6-dione?
1,5-dibromoadamantane-2,6-dione has a molecular weight of 322.00 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibromoadamantane-2,6-dione is sourced from PubChem (CID 2802823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).