About N-(3,5,7-trimethyl-1-adamantyl)acetamide
N-(3,5,7-trimethyl-1-adamantyl)acetamide (PubChem CID 2802835) has the molecular formula C15H25NO
and a molecular weight of 235.37 g/mol. Its IUPAC name is N-(3,5,7-trimethyl-1-adamantyl)acetamide.
Molecular Properties
| Compound Name | N-(3,5,7-trimethyl-1-adamantyl)acetamide |
| PubChem CID | 2802835 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-(3,5,7-trimethyl-1-adamantyl)acetamide |
| SMILES | CC(=O)NC12CC3(C)CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C15H25NO/c1-11(17)16-15-8-12(2)5-13(3,9-15)7-14(4,6-12)10-15/h5-10H2,1-4H3,(H,16,17) |
| InChIKey | DUJGMCOJTDEROR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,5,7-trimethyl-1-adamantyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5,7-trimethyl-1-adamantyl)acetamide?
The IUPAC name of N-(3,5,7-trimethyl-1-adamantyl)acetamide (CID 2802835) is N-(3,5,7-trimethyl-1-adamantyl)acetamide.
What is the SMILES notation for N-(3,5,7-trimethyl-1-adamantyl)acetamide?
The canonical SMILES for N-(3,5,7-trimethyl-1-adamantyl)acetamide is CC(=O)NC12CC3(C)CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of N-(3,5,7-trimethyl-1-adamantyl)acetamide?
The InChIKey is DUJGMCOJTDEROR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO/c1-11(17)16-15-8-12(2)5-13(3,9-15)7-14(4,6-12)10-15/h5-10H2,1-4H3,(H,16,17).
What are the key properties of N-(3,5,7-trimethyl-1-adamantyl)acetamide?
N-(3,5,7-trimethyl-1-adamantyl)acetamide has a molecular weight of 235.37 g/mol, XLogP of 3.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5,7-trimethyl-1-adamantyl)acetamide is sourced from PubChem (CID 2802835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).