About bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate
bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate (PubChem CID 2802917) has the molecular formula C25H36O6
and a molecular weight of 432.56 g/mol. Its IUPAC name is bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate |
| PubChem CID | 2802917 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate |
| SMILES | CC(C)CCOC(=O)C1(C(=O)OCCC(C)C)CC2(COC(c3ccccc3)OC2)C1 |
| InChI | InChI=1S/C25H36O6/c1-18(2)10-12-28-22(26)25(23(27)29-13-11-19(3)4)14-24(15-25)16-30-21(31-17-24)20-8-6-5-7-9-20/h5-9,18-19,21H,10-17H2,1-4H3 |
| InChIKey | XCKXNGXFYMQXNZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate?
The IUPAC name of bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate (CID 2802917) is bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate.
What is the SMILES notation for bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate?
The canonical SMILES for bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate is CC(C)CCOC(=O)C1(C(=O)OCCC(C)C)CC2(COC(c3ccccc3)OC2)C1.
What is the InChIKey of bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate?
The InChIKey is XCKXNGXFYMQXNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36O6/c1-18(2)10-12-28-22(26)25(23(27)29-13-11-19(3)4)14-24(15-25)16-30-21(31-17-24)20-8-6-5-7-9-20/h5-9,18-19,21H,10-17H2,1-4H3.
What are the key properties of bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate?
bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate has a molecular weight of 432.56 g/mol, XLogP of 4.68, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylbutyl) 7-phenyl-6,8-dioxaspiro[3.5]nonane-2,2-dicarboxylate is sourced from PubChem (CID 2802917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).