About 1-adamantylmethyl 4-methylbenzenesulfonate
1-adamantylmethyl 4-methylbenzenesulfonate (PubChem CID 2802936) has the molecular formula C18H24O3S
and a molecular weight of 320.45 g/mol. Its IUPAC name is 1-adamantylmethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 1-adamantylmethyl 4-methylbenzenesulfonate |
| PubChem CID | 2802936 |
| Molecular Formula | C18H24O3S |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-adamantylmethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H24O3S/c1-13-2-4-17(5-3-13)22(19,20)21-12-18-9-14-6-15(10-18)8-16(7-14)11-18/h2-5,14-16H,6-12H2,1H3 |
| InChIKey | SNDZRLLCQXBCQD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantylmethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylmethyl 4-methylbenzenesulfonate?
The IUPAC name of 1-adamantylmethyl 4-methylbenzenesulfonate (CID 2802936) is 1-adamantylmethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 1-adamantylmethyl 4-methylbenzenesulfonate?
The canonical SMILES for 1-adamantylmethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of 1-adamantylmethyl 4-methylbenzenesulfonate?
The InChIKey is SNDZRLLCQXBCQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O3S/c1-13-2-4-17(5-3-13)22(19,20)21-12-18-9-14-6-15(10-18)8-16(7-14)11-18/h2-5,14-16H,6-12H2,1H3.
What are the key properties of 1-adamantylmethyl 4-methylbenzenesulfonate?
1-adamantylmethyl 4-methylbenzenesulfonate has a molecular weight of 320.45 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylmethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 2802936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).