C20H21NO2 — CID 2803008
2-[(2,3,4,5,6-pentamethylphenyl)methyl]isoindole-1,3-dione (PubChem CID 2803008) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentamethylphenyl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(2,3,4,5,6-pentamethylphenyl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2803008 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 2-[(2,3,4,5,6-pentamethylphenyl)methyl]isoindole-1,3-dione |
| SMILES | Cc1c(C)c(C)c(CN2C(=O)c3ccccc3C2=O)c(C)c1C |
| InChI | InChI=1S/C20H21NO2/c1-11-12(2)14(4)18(15(5)13(11)3)10-21-19(22)16-8-6-7-9-17(16)20(21)23/h6-9H,10H2,1-5H3 |
| InChIKey | NBQDUYHXANYCAX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|