About (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide
(4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide (PubChem CID 2803023) has the molecular formula C14H14BrN3O2S
and a molecular weight of 368.26 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide |
| PubChem CID | 2803023 |
| Molecular Formula | C14H14BrN3O2S |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide |
| SMILES | Br.N/C(=N\c1ccccc1)SCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H13N3O2S.BrH/c15-14(16-12-4-2-1-3-5-12)20-10-11-6-8-13(9-7-11)17(18)19;/h1-9H,10H2,(H2,15,16);1H |
| InChIKey | PVMOAZKGODKNIU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide?
The IUPAC name of (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide (CID 2803023) is (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide.
What is the SMILES notation for (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide?
The canonical SMILES for (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide is Br.N/C(=N\c1ccccc1)SCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide?
The InChIKey is PVMOAZKGODKNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S.BrH/c15-14(16-12-4-2-1-3-5-12)20-10-11-6-8-13(9-7-11)17(18)19;/h1-9H,10H2,(H2,15,16);1H.
What are the key properties of (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide?
(4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide has a molecular weight of 368.26 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl N'-phenylcarbamimidothioate;hydrobromide is sourced from PubChem (CID 2803023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).