About 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea
8-tricyclo[5.2.1.02,6]dec-4-enylthiourea (PubChem CID 2803167) has the molecular formula C11H16N2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea.
Molecular Properties
| Compound Name | 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea |
| PubChem CID | 2803167 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea |
| SMILES | NC(=S)NC1CC2CC1C1C=CCC21 |
| InChI | InChI=1S/C11H16N2S/c12-11(14)13-10-5-6-4-9(10)8-3-1-2-7(6)8/h1,3,6-10H,2,4-5H2,(H3,12,13,14) |
| InChIKey | DHWGVLNGJNHMLY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea?
The IUPAC name of 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea (CID 2803167) is 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea.
What is the SMILES notation for 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea?
The canonical SMILES for 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea is NC(=S)NC1CC2CC1C1C=CCC21.
What is the InChIKey of 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea?
The InChIKey is DHWGVLNGJNHMLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2S/c12-11(14)13-10-5-6-4-9(10)8-3-1-2-7(6)8/h1,3,6-10H,2,4-5H2,(H3,12,13,14).
What are the key properties of 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea?
8-tricyclo[5.2.1.02,6]dec-4-enylthiourea has a molecular weight of 208.33 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tricyclo[5.2.1.02,6]dec-4-enylthiourea is sourced from PubChem (CID 2803167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).