C21H26N2O4 — CID 2803242
3,4,5-trimethoxy-N-(2-piperidin-1-ylphenyl)benzamide (PubChem CID 2803242) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-piperidin-1-ylphenyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(2-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 2803242 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-piperidin-1-ylphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccccc2N2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N2O4/c1-25-18-13-15(14-19(26-2)20(18)27-3)21(24)22-16-9-5-6-10-17(16)23-11-7-4-8-12-23/h5-6,9-10,13-14H,4,7-8,11-12H2,1-3H3,(H,22,24) |
| InChIKey | ONJMIFREWBTZGZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |