C14H20O — CID 2803272
1-(2,3,4,5,6-pentamethylphenyl)propan-1-one (PubChem CID 2803272) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentamethylphenyl)propan-1-one.
| Compound Name | 1-(2,3,4,5,6-pentamethylphenyl)propan-1-one |
|---|---|
| PubChem CID | 2803272 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-(2,3,4,5,6-pentamethylphenyl)propan-1-one |
| SMILES | CCC(=O)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C14H20O/c1-7-13(15)14-11(5)9(3)8(2)10(4)12(14)6/h7H2,1-6H3 |
| InChIKey | DMSGZSYJORVDHE-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |