C22H17Cl2NO4 — CID 2803430
3,4-dichloro-N-[4-(2,5-dimethoxybenzoyl)phenyl]benzamide (PubChem CID 2803430) has the molecular formula C22H17Cl2NO4 and a molecular weight of 430.29 g/mol. Its IUPAC name is 3,4-dichloro-N-[4-(2,5-dimethoxybenzoyl)phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[4-(2,5-dimethoxybenzoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2803430 |
| Molecular Formula | C22H17Cl2NO4 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 3,4-dichloro-N-[4-(2,5-dimethoxybenzoyl)phenyl]benzamide |
| SMILES | COc1ccc(OC)c(C(=O)c2ccc(NC(=O)c3ccc(Cl)c(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C22H17Cl2NO4/c1-28-16-8-10-20(29-2)17(12-16)21(26)13-3-6-15(7-4-13)25-22(27)14-5-9-18(23)19(24)11-14/h3-12H,1-2H3,(H,25,27) |
| InChIKey | NIRXPHCMVJGUDK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |