C25H26ClNO — CID 2803433
1-(4-chlorophenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]-1-phenylmethanimine (PubChem CID 2803433) has the molecular formula C25H26ClNO and a molecular weight of 391.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]-1-phenylmethanimine.
| Compound Name | 1-(4-chlorophenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]-1-phenylmethanimine |
|---|---|
| PubChem CID | 2803433 |
| Molecular Formula | C25H26ClNO |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(2,3,4,5,6-pentamethylphenyl)methoxy]-1-phenylmethanimine |
| SMILES | Cc1c(C)c(C)c(CON=C(c2ccccc2)c2ccc(Cl)cc2)c(C)c1C |
| InChI | InChI=1S/C25H26ClNO/c1-16-17(2)19(4)24(20(5)18(16)3)15-28-27-25(21-9-7-6-8-10-21)22-11-13-23(26)14-12-22/h6-14H,15H2,1-5H3 |
| InChIKey | ACQFBLWSZWSIRC-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|