C19H22N2O — CID 2803521
2-hydrazinylidene-1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethanone (PubChem CID 2803521) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-hydrazinylidene-1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethanone.
| Compound Name | 2-hydrazinylidene-1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethanone |
|---|---|
| PubChem CID | 2803521 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-hydrazinylidene-1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethanone |
| SMILES | Cc1c(C)c(C)c(C(=O)C(=NN)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C19H22N2O/c1-11-12(2)14(4)17(15(5)13(11)3)19(22)18(21-20)16-9-7-6-8-10-16/h6-10H,20H2,1-5H3 |
| InChIKey | PKPLICUVJGFQLF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|