About 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one
4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one (PubChem CID 2803665) has the molecular formula C13H13Cl2N3O2
and a molecular weight of 314.17 g/mol. Its IUPAC name is 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one.
Molecular Properties
| Compound Name | 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one |
| PubChem CID | 2803665 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one |
| SMILES | O=C1NN=CC1CCC/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H13Cl2N3O2/c14-10-4-9(12(19)11(15)5-10)6-16-3-1-2-8-7-17-18-13(8)20/h4-8,19H,1-3H2,(H,18,20)/b16-6+ |
| InChIKey | QWAVLXQSJRZFHH-OMCISZLKSA-N |
| XLogP | 2.63 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one?
The IUPAC name of 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one (CID 2803665) is 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one.
What is the SMILES notation for 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one?
The canonical SMILES for 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one is O=C1NN=CC1CCC/N=C/c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one?
The InChIKey is QWAVLXQSJRZFHH-OMCISZLKSA-N. The full InChI is InChI=1S/C13H13Cl2N3O2/c14-10-4-9(12(19)11(15)5-10)6-16-3-1-2-8-7-17-18-13(8)20/h4-8,19H,1-3H2,(H,18,20)/b16-6+.
What are the key properties of 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one?
4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one has a molecular weight of 314.17 g/mol, XLogP of 2.63, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propyl]-1,4-dihydropyrazol-5-one is sourced from PubChem (CID 2803665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).