About 1-(2,3,5,6-tetrachlorophenyl)pyrrole
1-(2,3,5,6-tetrachlorophenyl)pyrrole (PubChem CID 2803775) has the molecular formula C10H5Cl4N
and a molecular weight of 280.97 g/mol. Its IUPAC name is 1-(2,3,5,6-tetrachlorophenyl)pyrrole.
Molecular Properties
| Compound Name | 1-(2,3,5,6-tetrachlorophenyl)pyrrole |
| PubChem CID | 2803775 |
| Molecular Formula | C10H5Cl4N |
| Molecular Weight | 280.97 g/mol |
| Exact Mass | 278.92 |
| IUPAC Name | 1-(2,3,5,6-tetrachlorophenyl)pyrrole |
| SMILES | Clc1cc(Cl)c(Cl)c(-n2cccc2)c1Cl |
| InChI | InChI=1S/C10H5Cl4N/c11-6-5-7(12)9(14)10(8(6)13)15-3-1-2-4-15/h1-5H |
| InChIKey | TZDGDKGBXZCKAF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.97 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3,5,6-tetrachlorophenyl)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3,5,6-tetrachlorophenyl)pyrrole?
The IUPAC name of 1-(2,3,5,6-tetrachlorophenyl)pyrrole (CID 2803775) is 1-(2,3,5,6-tetrachlorophenyl)pyrrole.
What is the SMILES notation for 1-(2,3,5,6-tetrachlorophenyl)pyrrole?
The canonical SMILES for 1-(2,3,5,6-tetrachlorophenyl)pyrrole is Clc1cc(Cl)c(Cl)c(-n2cccc2)c1Cl.
What is the InChIKey of 1-(2,3,5,6-tetrachlorophenyl)pyrrole?
The InChIKey is TZDGDKGBXZCKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl4N/c11-6-5-7(12)9(14)10(8(6)13)15-3-1-2-4-15/h1-5H.
What are the key properties of 1-(2,3,5,6-tetrachlorophenyl)pyrrole?
1-(2,3,5,6-tetrachlorophenyl)pyrrole has a molecular weight of 280.97 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3,5,6-tetrachlorophenyl)pyrrole is sourced from PubChem (CID 2803775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).