C14H7F3N2O6S — CID 2803887
2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid (PubChem CID 2803887) has the molecular formula C14H7F3N2O6S and a molecular weight of 388.28 g/mol. Its IUPAC name is 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid.
| Compound Name | 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 2803887 |
| Molecular Formula | C14H7F3N2O6S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanylbenzoic acid |
| SMILES | O=C(O)c1ccccc1Sc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7F3N2O6S/c15-14(16,17)7-5-9(18(22)23)12(10(6-7)19(24)25)26-11-4-2-1-3-8(11)13(20)21/h1-6H,(H,20,21) |
| InChIKey | IKWFQXGEZRZQLT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|