C18H28N2 — CID 2803910
1,1,3,3,5-pentamethyl-6-pyrrolidin-1-yl-2H-inden-4-amine (PubChem CID 2803910) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1,1,3,3,5-pentamethyl-6-pyrrolidin-1-yl-2H-inden-4-amine.
| Compound Name | 1,1,3,3,5-pentamethyl-6-pyrrolidin-1-yl-2H-inden-4-amine |
|---|---|
| PubChem CID | 2803910 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1,1,3,3,5-pentamethyl-6-pyrrolidin-1-yl-2H-inden-4-amine |
| SMILES | Cc1c(N2CCCC2)cc2c(c1N)C(C)(C)CC2(C)C |
| InChI | InChI=1S/C18H28N2/c1-12-14(20-8-6-7-9-20)10-13-15(16(12)19)18(4,5)11-17(13,2)3/h10H,6-9,11,19H2,1-5H3 |
| InChIKey | CNIVMOUHLRLZOK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|