C18H12Cl2F6N2O2 — CID 2803977
3-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 2803977) has the molecular formula C18H12Cl2F6N2O2 and a molecular weight of 473.20 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 2803977 |
| Molecular Formula | C18H12Cl2F6N2O2 |
| Molecular Weight | 473.20 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-[(3,5-dichloro-2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | O=C(CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NN=Cc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C18H12Cl2F6N2O2/c19-13-5-10(16(30)14(20)7-13)8-27-28-15(29)2-1-9-3-11(17(21,22)23)6-12(4-9)18(24,25)26/h3-8,30H,1-2H2,(H,28,29) |
| InChIKey | CLPIOSPONJKZDY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.20 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|