About 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid
1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid (PubChem CID 2804084) has the molecular formula C17H9F6N3O2
and a molecular weight of 401.27 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid |
| PubChem CID | 2804084 |
| Molecular Formula | C17H9F6N3O2 |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H9F6N3O2/c18-16(19,20)10-6-11(17(21,22)23)8-12(7-10)26-14(9-4-2-1-3-5-9)13(15(27)28)24-25-26/h1-8H,(H,27,28) |
| InChIKey | PSSINRKVBATWGB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid (CID 2804084) is 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid is O=C(O)c1nnn(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1ccccc1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid?
The InChIKey is PSSINRKVBATWGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9F6N3O2/c18-16(19,20)10-6-11(17(21,22)23)8-12(7-10)26-14(9-4-2-1-3-5-9)13(15(27)28)24-25-26/h1-8H,(H,27,28).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid?
1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid has a molecular weight of 401.27 g/mol, XLogP of 4.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-5-phenyltriazole-4-carboxylic acid is sourced from PubChem (CID 2804084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).