About 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid
3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid (PubChem CID 2804100) has the molecular formula C20H21ClO3S
and a molecular weight of 376.91 g/mol. Its IUPAC name is 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid |
| PubChem CID | 2804100 |
| Molecular Formula | C20H21ClO3S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid |
| SMILES | Cc1cc(C)c(C(=O)Sc2ccc(Cl)cc2)c(CC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C20H21ClO3S/c1-12-9-13(2)17(14(10-12)11-20(3,4)19(23)24)18(22)25-16-7-5-15(21)6-8-16/h5-10H,11H2,1-4H3,(H,23,24) |
| InChIKey | UEIYYIDGVFOFEI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid (CID 2804100) is 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid is Cc1cc(C)c(C(=O)Sc2ccc(Cl)cc2)c(CC(C)(C)C(=O)O)c1.
What is the InChIKey of 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid?
The InChIKey is UEIYYIDGVFOFEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21ClO3S/c1-12-9-13(2)17(14(10-12)11-20(3,4)19(23)24)18(22)25-16-7-5-15(21)6-8-16/h5-10H,11H2,1-4H3,(H,23,24).
What are the key properties of 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid?
3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid has a molecular weight of 376.91 g/mol, XLogP of 5.54, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-chlorophenyl)sulfanylcarbonyl-3,5-dimethylphenyl]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 2804100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).