About N-(4-bromo-2,6-difluorophenyl)acetamide
N-(4-bromo-2,6-difluorophenyl)acetamide (PubChem CID 2804166) has the molecular formula C8H6BrF2NO
and a molecular weight of 250.04 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)acetamide.
Molecular Properties
| Compound Name | N-(4-bromo-2,6-difluorophenyl)acetamide |
| PubChem CID | 2804166 |
| Molecular Formula | C8H6BrF2NO |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)acetamide |
| SMILES | CC(=O)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C8H6BrF2NO/c1-4(13)12-8-6(10)2-5(9)3-7(8)11/h2-3H,1H3,(H,12,13) |
| InChIKey | OXMOETOVMNVVOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-bromo-2,6-difluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,6-difluorophenyl)acetamide?
The IUPAC name of N-(4-bromo-2,6-difluorophenyl)acetamide (CID 2804166) is N-(4-bromo-2,6-difluorophenyl)acetamide.
What is the SMILES notation for N-(4-bromo-2,6-difluorophenyl)acetamide?
The canonical SMILES for N-(4-bromo-2,6-difluorophenyl)acetamide is CC(=O)Nc1c(F)cc(Br)cc1F.
What is the InChIKey of N-(4-bromo-2,6-difluorophenyl)acetamide?
The InChIKey is OXMOETOVMNVVOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrF2NO/c1-4(13)12-8-6(10)2-5(9)3-7(8)11/h2-3H,1H3,(H,12,13).
What are the key properties of N-(4-bromo-2,6-difluorophenyl)acetamide?
N-(4-bromo-2,6-difluorophenyl)acetamide has a molecular weight of 250.04 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,6-difluorophenyl)acetamide is sourced from PubChem (CID 2804166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).