About N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide
N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide (PubChem CID 2804173) has the molecular formula C8H4BrCl2F2NO
and a molecular weight of 318.93 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide.
Molecular Properties
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide |
| PubChem CID | 2804173 |
| Molecular Formula | C8H4BrCl2F2NO |
| Molecular Weight | 318.93 g/mol |
| Exact Mass | 316.88 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide |
| SMILES | O=C(Nc1c(F)cc(Br)cc1F)C(Cl)Cl |
| InChI | InChI=1S/C8H4BrCl2F2NO/c9-3-1-4(12)6(5(13)2-3)14-8(15)7(10)11/h1-2,7H,(H,14,15) |
| InChIKey | YWOLTIBHODLLFC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.93 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide?
The IUPAC name of N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide (CID 2804173) is N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide.
What is the SMILES notation for N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide?
The canonical SMILES for N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide is O=C(Nc1c(F)cc(Br)cc1F)C(Cl)Cl.
What is the InChIKey of N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide?
The InChIKey is YWOLTIBHODLLFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrCl2F2NO/c9-3-1-4(12)6(5(13)2-3)14-8(15)7(10)11/h1-2,7H,(H,14,15).
What are the key properties of N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide?
N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide has a molecular weight of 318.93 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,6-difluorophenyl)-2,2-dichloroacetamide is sourced from PubChem (CID 2804173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).