About 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline
2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline (PubChem CID 2804192) has the molecular formula C9H9F2N5
and a molecular weight of 225.20 g/mol. Its IUPAC name is 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline.
Molecular Properties
| Compound Name | 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline |
| PubChem CID | 2804192 |
| Molecular Formula | C9H9F2N5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline |
| SMILES | CN(C)c1c(F)cc(-c2nn[nH]n2)cc1F |
| InChI | InChI=1S/C9H9F2N5/c1-16(2)8-6(10)3-5(4-7(8)11)9-12-14-15-13-9/h3-4H,1-2H3,(H,12,13,14,15) |
| InChIKey | HXPUWFONCVJJJH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline?
The IUPAC name of 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline (CID 2804192) is 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline.
What is the SMILES notation for 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline?
The canonical SMILES for 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline is CN(C)c1c(F)cc(-c2nn[nH]n2)cc1F.
What is the InChIKey of 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline?
The InChIKey is HXPUWFONCVJJJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2N5/c1-16(2)8-6(10)3-5(4-7(8)11)9-12-14-15-13-9/h3-4H,1-2H3,(H,12,13,14,15).
What are the key properties of 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline?
2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline has a molecular weight of 225.20 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluoro-N,N-dimethyl-4-(2H-tetrazol-5-yl)aniline is sourced from PubChem (CID 2804192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).