C13H14N2S — CID 2804385
2-(2-prop-2-ynylsulfanylphenyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 2804385) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 2-(2-prop-2-ynylsulfanylphenyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(2-prop-2-ynylsulfanylphenyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 2804385 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(2-prop-2-ynylsulfanylphenyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | C#CCSc1ccccc1C1=NCCCN1 |
| InChI | InChI=1S/C13H14N2S/c1-2-10-16-12-7-4-3-6-11(12)13-14-8-5-9-15-13/h1,3-4,6-7H,5,8-10H2,(H,14,15) |
| InChIKey | INAIBZSAAISUFO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|