C18H24N2O2S — CID 2804594
2,3,4,5,6-pentamethyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide (PubChem CID 2804594) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2804594 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-(2-pyridin-2-ylethyl)benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCc2ccccn2)c(C)c1C |
| InChI | InChI=1S/C18H24N2O2S/c1-12-13(2)15(4)18(16(5)14(12)3)23(21,22)20-11-9-17-8-6-7-10-19-17/h6-8,10,20H,9,11H2,1-5H3 |
| InChIKey | XSKVQSVVZXUQNZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |