About 2,3-diethylquinoxaline
2,3-diethylquinoxaline (PubChem CID 2804829) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2,3-diethylquinoxaline.
Molecular Properties
| Compound Name | 2,3-diethylquinoxaline |
| PubChem CID | 2804829 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2,3-diethylquinoxaline |
| SMILES | CCc1nc2ccccc2nc1CC |
| InChI | InChI=1S/C12H14N2/c1-3-9-10(4-2)14-12-8-6-5-7-11(12)13-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | HPPAQDIWWPYTAM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethylquinoxaline?
The IUPAC name of 2,3-diethylquinoxaline (CID 2804829) is 2,3-diethylquinoxaline.
What is the SMILES notation for 2,3-diethylquinoxaline?
The canonical SMILES for 2,3-diethylquinoxaline is CCc1nc2ccccc2nc1CC.
What is the InChIKey of 2,3-diethylquinoxaline?
The InChIKey is HPPAQDIWWPYTAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-3-9-10(4-2)14-12-8-6-5-7-11(12)13-9/h5-8H,3-4H2,1-2H3.
What are the key properties of 2,3-diethylquinoxaline?
2,3-diethylquinoxaline has a molecular weight of 186.26 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethylquinoxaline is sourced from PubChem (CID 2804829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).