C16H16Cl2N4O2 — CID 2804933
N-[amino(pyrrolidin-1-yl)methylidene]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 2804933) has the molecular formula C16H16Cl2N4O2 and a molecular weight of 367.24 g/mol. Its IUPAC name is N-[amino(pyrrolidin-1-yl)methylidene]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[amino(pyrrolidin-1-yl)methylidene]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 2804933 |
| Molecular Formula | C16H16Cl2N4O2 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | N-[amino(pyrrolidin-1-yl)methylidene]-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2c(Cl)cccc2Cl)c1C(=O)/N=C(\N)N1CCCC1 |
| InChI | InChI=1S/C16H16Cl2N4O2/c1-9-12(15(23)20-16(19)22-7-2-3-8-22)14(21-24-9)13-10(17)5-4-6-11(13)18/h4-6H,2-3,7-8H2,1H3,(H2,19,20,23) |
| InChIKey | NIYGHLFZKWUHJC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|