C16H25NS — CID 2804957
4-[(2,3,4,5,6-pentamethylphenyl)methyl]thiomorpholine (PubChem CID 2804957) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is 4-[(2,3,4,5,6-pentamethylphenyl)methyl]thiomorpholine.
| Compound Name | 4-[(2,3,4,5,6-pentamethylphenyl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 2804957 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-[(2,3,4,5,6-pentamethylphenyl)methyl]thiomorpholine |
| SMILES | Cc1c(C)c(C)c(CN2CCSCC2)c(C)c1C |
| InChI | InChI=1S/C16H25NS/c1-11-12(2)14(4)16(15(5)13(11)3)10-17-6-8-18-9-7-17/h6-10H2,1-5H3 |
| InChIKey | YONOEZZTUAGYKJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |