About (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate
(3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 2805023) has the molecular formula C14H6Cl2F6O3S
and a molecular weight of 439.16 g/mol. Its IUPAC name is (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate |
| PubChem CID | 2805023 |
| Molecular Formula | C14H6Cl2F6O3S |
| Molecular Weight | 439.16 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)(Oc1cc(Cl)cc(Cl)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H6Cl2F6O3S/c15-9-4-10(16)6-11(5-9)25-26(23,24)12-2-7(13(17,18)19)1-8(3-12)14(20,21)22/h1-6H |
| InChIKey | DQHSIXVTNZLLJY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.16 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate?
The IUPAC name of (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate (CID 2805023) is (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate?
The canonical SMILES for (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate is O=S(=O)(Oc1cc(Cl)cc(Cl)c1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate?
The InChIKey is DQHSIXVTNZLLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Cl2F6O3S/c15-9-4-10(16)6-11(5-9)25-26(23,24)12-2-7(13(17,18)19)1-8(3-12)14(20,21)22/h1-6H.
What are the key properties of (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate?
(3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate has a molecular weight of 439.16 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dichlorophenyl) 3,5-bis(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 2805023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).